O-(2-Methylpropyl) O-octan-2-yl hydrogen phosphorodithioate structure
|
Common Name | O-(2-Methylpropyl) O-octan-2-yl hydrogen phosphorodithioate | ||
|---|---|---|---|---|
| CAS Number | 83168-71-2 | Molecular Weight | 298.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H27O2PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | O-(2-Methylpropyl) O-octan-2-yl hydrogen phosphorodithioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H27O2PS2 |
|---|---|
| Molecular Weight | 298.5 |
| InChIKey | JTHKUDYWUUQSST-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)OP(=S)(S)OCC(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of O-(2-Methylpropyl) O-octan-2-yl hydrogen phosphorodithioate? |
| A: SMILES notation of O-(2-Methylpropyl) O-octan-2-yl hydrogen phosphorodithioate is CCCCCCC(C)OP(=S)(S)OCC(C)C. |
| Q: What is the CAS number of O-(2-Methylpropyl) O-octan-2-yl hydrogen phosphorodithioate? |
| A: CAS number of O-(2-Methylpropyl) O-octan-2-yl hydrogen phosphorodithioate is 83168-71-2. |
| Q: What is the InChIKey of O-(2-Methylpropyl) O-octan-2-yl hydrogen phosphorodithioate? |
| A: InChIKey of O-(2-Methylpropyl) O-octan-2-yl hydrogen phosphorodithioate is JTHKUDYWUUQSST-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 83168-71-2? |
| A: Chinese name of 83168-71-2 is 83168-71-2. |
| Q: What is the English name of O-(2-Methylpropyl) O-octan-2-yl hydrogen phosphorodithioate? |
| A: The English name of O-(2-Methylpropyl) O-octan-2-yl hydrogen phosphorodithioate is O-(2-Methylpropyl) O-octan-2-yl hydrogen phosphorodithioate. |
| Q: What is the molecular weight of O-(2-Methylpropyl) O-octan-2-yl hydrogen phosphorodithioate? |
| A: Molecular weight of O-(2-Methylpropyl) O-octan-2-yl hydrogen phosphorodithioate is 298.5. |
| Q: What is the molecular formula of O-(2-Methylpropyl) O-octan-2-yl hydrogen phosphorodithioate? |
| A: Molecular formula of O-(2-Methylpropyl) O-octan-2-yl hydrogen phosphorodithioate is C12H27O2PS2. |