2-benzofuran-1,3-dione,hexane-1,6-diol,2,2,4-trimethylpentane-1,3-diol structure
|
Common Name | 2-benzofuran-1,3-dione,hexane-1,6-diol,2,2,4-trimethylpentane-1,3-diol | ||
|---|---|---|---|---|
| CAS Number | 83175-08-0 | Molecular Weight | 412.51700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H36O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-benzofuran-1,3-dione,hexane-1,6-diol,2,2,4-trimethylpentane-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H36O7 |
|---|---|
| Molecular Weight | 412.51700 |
| Exact Mass | 412.24600 |
| PSA | 124.29000 |
| LogP | 2.55040 |
| InChIKey | DWZABZXCKRXNND-UHFFFAOYSA-N |
| SMILES | CC(C)C(O)C(C)(C)CO.O=C1OC(=O)c2ccccc21.OCCCCCCO |
| 1,3-Isobenzofurandione,polymer with 1,6-hexanediol and 2,2,4-trimethyl-1,3-pentanediol |