p-((1-Carboxyethyl)sulfamoyl)carbanilic acid 1-methyl ester compd. wit h 2-aminoethanol
Modify Date: 2025-09-13 06:40:56
p-((1-Carboxyethyl)sulfamoyl)carbanilic acid 1-methyl ester compd. wit h 2-aminoethanol structure
|
Common Name | p-((1-Carboxyethyl)sulfamoyl)carbanilic acid 1-methyl ester compd. wit h 2-aminoethanol | ||
|---|---|---|---|---|
| CAS Number | 83192-81-8 | Molecular Weight | 363.38700 | |
| Density | N/A | Boiling Point | 579.2ºC at 760 mmHg | |
| Molecular Formula | C13H21N3O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.1ºC | |
| Name | 2-aminoethanol,(2R)-2-[[4-(methoxycarbonylamino)phenyl]sulfonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 579.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H21N3O7S |
| Molecular Weight | 363.38700 |
| Flash Point | 304.1ºC |
| Exact Mass | 363.11000 |
| PSA | 176.43000 |
| LogP | 1.79870 |
| InChIKey | JBXCSLWKHMARGT-OGFXRTJISA-N |
| SMILES | COC(=O)Nc1ccc(S(=O)(=O)NC(C)C(=O)O)cc1.NCCO |
| HS Code | 2935009090 |
|---|
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| D-Alanine,N-((4-((methoxycarbonyl)amino)phenyl)sulfonyl)-,compd. with 2-aminoethanol (1:1) |
| p-((1-Carboxyethyl)sulfamoyl)carbanilic acid 1-methyl ester compd. with 2-aminoethanol |
| Carbanilic acid,p-((1-carboxyethyl)sulfamoyl)-,1-methyl ester,compd. with 2-aminoethanol,D |
| (2R)-2-[[4-(methoxycarbonylamino)phenyl]sulfonylamino]propanoic acid |