4-methylsulfonyl-6-thiophen-2-ylpyrimidin-2-amine
Modify Date: 2025-09-09 01:29:46
4-methylsulfonyl-6-thiophen-2-ylpyrimidin-2-amine structure
|
Common Name | 4-methylsulfonyl-6-thiophen-2-ylpyrimidin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 832075-86-2 | Molecular Weight | 255.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9N3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methylsulfonyl-6-thiophen-2-ylpyrimidin-2-amine |
|---|
| Molecular Formula | C9H9N3O2S2 |
|---|---|
| Molecular Weight | 255.31700 |
| Exact Mass | 255.01400 |
| PSA | 123.29000 |
| LogP | 2.20170 |
| InChIKey | WSRMKWFNLWDWPX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1cc(-c2cccs2)nc(N)n1 |
|
~%
4-methylsulfony... CAS#:832075-86-2 |
| Literature: Katiyar, Sanjay Babu; Bansal, Iti; Saxena; Chauhan Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 1 p. 47 - 50 |
|
~%
4-methylsulfony... CAS#:832075-86-2 |
| Literature: Katiyar, Sanjay Babu; Bansal, Iti; Saxena; Chauhan Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 1 p. 47 - 50 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |