2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole
2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole structure
|
Common Name | 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole | ||
|---|---|---|---|---|
| CAS Number | 832076-75-2 | Molecular Weight | 252.10700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: The Chinese name of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole is 2-(3-溴苯基)-4,5-二甲基-1,3-恶唑，with an English name of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole，CAS number 832076-75-2，molecular formula C11H10BrNO，and molecular weight 252.11. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10BrNO |
|---|---|
| Molecular Weight | 252.10700 |
| Exact Mass | 250.99500 |
| PSA | 26.03000 |
| LogP | 3.72090 |
| InChIKey | RYTDSVZFTBOFOW-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2cccc(Br)c2)oc1C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:328918-94-1This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole? |
| A: InChIKey of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole is RYTDSVZFTBOFOW-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole? |
| A: Molecular formula of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole is C11H10BrNO. |
| Q: What is the CAS number of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole? |
| A: CAS number of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole is 832076-75-2. |
| Q: What is the English name of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole? |
| A: The English name of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole is 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole. |
| Q: What is the SMILES notation of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole? |
| A: SMILES notation of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole is Cc1nc(-c2cccc(Br)c2)oc1C. |
| Q: What is the molecular weight of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole? |
| A: Molecular weight of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole is 252.10700. |
| Q: What is the Chinese name of 832076-75-2? |
| A: Chinese name of 832076-75-2 is 832076-75-2. |
| Q: What is the LogP of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole? |
| A: LogP of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole is 3.72090. |
| Q: What is the polar surface area (PSA) of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole? |
| A: Polar surface area (PSA) of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole is 26.03000. |
| Q: What are the downstream products of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole? |
| A: Related downstream products(CAS) of 2-(3-bromophenyl)-4,5-dimethyl-1,3-oxazole: 328918-94-1. |