benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate
benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate structure
|
Common Name | benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 832142-18-4 | Molecular Weight | 284.32800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16O5S |
|---|---|
| Molecular Weight | 284.32800 |
| Exact Mass | 284.07200 |
| PSA | 78.05000 |
| LogP | 2.70950 |
| InChIKey | ARUAYUYUSMWDQY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1(CC(=O)OCc2ccccc2)CC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~84%
benzyl 2-(1-met... CAS#:832142-18-4 |
| Literature: Limbach, Michael; Dalai, Suryakanta; De Meijere, Armin Advanced Synthesis and Catalysis, 2004 , vol. 346, # 7 p. 760 - 766 |
|
~%
benzyl 2-(1-met... CAS#:832142-18-4 |
| Literature: Limbach, Michael; Dalai, Suryakanta; De Meijere, Armin Advanced Synthesis and Catalysis, 2004 , vol. 346, # 7 p. 760 - 766 |
|
~%
benzyl 2-(1-met... CAS#:832142-18-4 |
| Literature: Limbach, Michael; Dalai, Suryakanta; De Meijere, Armin Advanced Synthesis and Catalysis, 2004 , vol. 346, # 7 p. 760 - 766 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate? |
| A: CAS number of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate is 832142-18-4. |
| Q: What is the LogP of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate? |
| A: LogP of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate is 2.70950. |
| Q: What is the SMILES notation of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate? |
| A: SMILES notation of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate is CS(=O)(=O)OC1(CC(=O)OCc2ccccc2)CC1. |
| Q: What is the polar surface area (PSA) of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate? |
| A: Polar surface area (PSA) of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate is 78.05000. |
| Q: What is the English name of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate? |
| A: The English name of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate is benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate. |
| Q: What are the upstream materials of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate? |
| A: Related upstream materials(CAS) of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate: 100-51-6;832142-14-0;832142-15-1;832142-17-3. |
| Q: What is the molecular weight of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate? |
| A: Molecular weight of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate is 284.32800. |
| Q: What is the Chinese name of 832142-18-4? |
| A: Chinese name of 832142-18-4 is 832142-18-4. |
| Q: What is the InChIKey of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate? |
| A: InChIKey of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate is ARUAYUYUSMWDQY-UHFFFAOYSA-N. |
| Q: What is the molecular formula of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate? |
| A: Molecular formula of benzyl 2-(1-methylsulfonyloxycyclopropyl)acetate is C13H16O5S. |