4,6-Dichloro-2-(4-methoxyphenyl)pyrimidine structure
|
Common Name | 4,6-Dichloro-2-(4-methoxyphenyl)pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 83217-08-7 | Molecular Weight | 255.10000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,6-Dichloro-2-(4-methoxyphenyl)pyrimidine |
|---|
| Molecular Formula | C11H8Cl2N2O |
|---|---|
| Molecular Weight | 255.10000 |
| Exact Mass | 254.00100 |
| PSA | 35.01000 |
| LogP | 3.45900 |
| InChIKey | CHLAKIWCDADMAD-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc(Cl)cc(Cl)n2)cc1 |
| Storage condition | 2-8°C, sealed storage, away from moisture |
| HS Code | 2933599090 |
|---|
|
~%
4,6-Dichloro-2-... CAS#:83217-08-7 |
| Literature: Hendry; Homer Journal of the Chemical Society, 1952 , p. 328,333 |
|
~%
4,6-Dichloro-2-... CAS#:83217-08-7 |
| Literature: Berlex Laboratories, Inc. Patent: US6372751 B1, 2002 ; Location in patent: Example Pr3 ; |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |