5-chloro-N-diazothiophene-2-sulfonamide structure
|
Common Name | 5-chloro-N-diazothiophene-2-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 83222-18-8 | Molecular Weight | 223.66100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H2ClN3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-chloro-N-diazothiophene-2-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4H2ClN3O2S2 |
|---|---|
| Molecular Weight | 223.66100 |
| Exact Mass | 222.92800 |
| PSA | 120.51000 |
| LogP | 2.93406 |
| InChIKey | ZHBGNVWOUJIQGC-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NS(=O)(=O)c1ccc(Cl)s1 |
|
~75%
5-chloro-N-diaz... CAS#:83222-18-8 |
| Literature: Obafemi, Craig A. Phosphorus and Sulfur and the Related Elements, 1982 , vol. 13, p. 119 - 132 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-chloro-2-thiophenesulfonyl azide |
| 5-chlorothien-2-ylsulfonyl azide |
| 5-chlorothiophene-2-sulfonyl azide |
| 2-Thiophenesulfonyl azide,5-chloro |