5-(1-Carboxyethyl)-2-(phenylthio)phenylacetic acid structure
|
Common Name | 5-(1-Carboxyethyl)-2-(phenylthio)phenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 83237-49-4 | Molecular Weight | 316.371 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 517.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H16O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.7±30.1 °C | |
| Name | 5-(1-Carboxyethyl)-2-(phenylthio)phenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 517.4±50.0 °C at 760 mmHg |
| Molecular Formula | C17H16O4S |
| Molecular Weight | 316.371 |
| Flash Point | 266.7±30.1 °C |
| Exact Mass | 316.076935 |
| PSA | 99.90000 |
| LogP | 3.37 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | HCKQCCUGCHJSOS-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)c1ccc(Sc2ccccc2)c(CC(=O)O)c1 |
| HS Code | 2930909090 |
|---|
|
~41%
5-(1-Carboxyeth... CAS#:83237-49-4 |
| Literature: Nippon Chemiphar Co., Ltd.; Ube Industries, Ltd. Patent: US6111115 A1, 2000 ; |
|
~48%
5-(1-Carboxyeth... CAS#:83237-49-4 |
| Literature: Nippon Chemiphar Co., Ltd.; Ube Industries, Ltd. Patent: US6111115 A1, 2000 ; |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-(A-CARBOXY ETHYL)-2-PHENYL THIOPHENYL ACETICACID |
| 5-(-carboxyethyl)-2-phenylthio-phenylacetic acid (intermediate of zaltoprofen) |
| 2-[3-(Carboxymethyl)-4-(phenylsulfanyl)phenyl]propanoic acid |
| 2-(3-carboxymethyl-4-phenylthiophenyl)propionic acid |
| 5-(1-carboxyethyl)-2-phenylthiophenylacetic acid |