N-[(3-phenyl-6-thia-1,4-diazabicyclo[3.3.0]octa-2,4-dien-2-yl)methylidene]hydroxylamine structure
|
Common Name | N-[(3-phenyl-6-thia-1,4-diazabicyclo[3.3.0]octa-2,4-dien-2-yl)methylidene]hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 83253-33-2 | Molecular Weight | 245.30000 | |
| Density | 1.42g/cm3 | Boiling Point | 507.6ºC at 760 mmHg | |
| Molecular Formula | C12H11N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.8ºC | |
| Name | (NE)-N-[(6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 507.6ºC at 760 mmHg |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.30000 |
| Flash Point | 260.8ºC |
| Exact Mass | 245.06200 |
| PSA | 75.71000 |
| LogP | 2.46390 |
| Index of Refraction | 1.732 |
| InChIKey | KLWCYSLWARGWJD-MDWZMJQESA-N |
| SMILES | ON=Cc1c(-c2ccccc2)nc2n1CCS2 |
|
~%
N-[(3-phenyl-6-... CAS#:83253-33-2 |
| Literature: Andreani; Bonazzi; Rambaldi; et al. European Journal of Medicinal Chemistry, 1982 , vol. 17, # 3 p. 271 - 274 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| (hydroxyimino)(6-phenyl(2H,3H-imidazo[2,1-b]1,3-thiazolidin-5-yl))methane |
| HMS1449H01 |