Carbamic acid,[1,2-dihydro-3-[(methylphenylamino)methyl]pyrido[3,4-b]pyrazine-5,7-diyl]bis-,diethyl ester (9CI) structure
|
Common Name | Carbamic acid,[1,2-dihydro-3-[(methylphenylamino)methyl]pyrido[3,4-b]pyrazine-5,7-diyl]bis-,diethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 83269-03-8 | Molecular Weight | 426.46900 | |
| Density | 1.31g/cm3 | Boiling Point | 534.5ºC at 760 mmHg | |
| Molecular Formula | C21H26N6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277ºC | |
| Name | ethyl N-[5-(ethoxycarbonylamino)-3-[(N-methylanilino)methyl]-1,2-dihydropyrido[3,4-b]pyrazin-7-yl]carbamate |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 534.5ºC at 760 mmHg |
| Molecular Formula | C21H26N6O4 |
| Molecular Weight | 426.46900 |
| Flash Point | 277ºC |
| Exact Mass | 426.20200 |
| PSA | 117.18000 |
| LogP | 3.57240 |
| Index of Refraction | 1.626 |
| InChIKey | FPRJPWDEHSBSIK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1cc2c(c(NC(=O)OCC)n1)N=C(CN(C)c1ccccc1)CN2 |
|
~41%
Carbamic acid,[... CAS#:83269-03-8 |
| Literature: Temple Jr.; Wheeler; Elliott; Rose; Comber; Montgomery Journal of Medicinal Chemistry, 1983 , vol. 26, # 1 p. 91 - 95 |