ethyl N-[2-amino-9-[(methyl-phenyl-amino)methyl]-3,7,10-triazabicyclo[4.4.0]deca-1,3,5,7,9-pentaen-4-yl]carbamate structure
|
Common Name | ethyl N-[2-amino-9-[(methyl-phenyl-amino)methyl]-3,7,10-triazabicyclo[4.4.0]deca-1,3,5,7,9-pentaen-4-yl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 83269-13-0 | Molecular Weight | 352.39000 | |
| Density | 1.354g/cm3 | Boiling Point | 531.6ºC at 760 mmHg | |
| Molecular Formula | C18H20N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.3ºC | |
| Name | ethyl N-[5-amino-3-[(N-methylanilino)methyl]pyrido[3,4-b]pyrazin-7-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.354g/cm3 |
|---|---|
| Boiling Point | 531.6ºC at 760 mmHg |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.39000 |
| Flash Point | 275.3ºC |
| Exact Mass | 352.16500 |
| PSA | 106.26000 |
| LogP | 3.46600 |
| Index of Refraction | 1.713 |
| InChIKey | OBFVNBRZIVSPNH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1cc2ncc(CN(C)c3ccccc3)nc2c(N)n1 |
|
~12%
ethyl N-[2-amin... CAS#:83269-13-0 |
| Literature: Temple Jr.; Wheeler; Elliott; Rose; Comber; Montgomery Journal of Medicinal Chemistry, 1983 , vol. 26, # 1 p. 91 - 95 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| ethyl 5-amino-3-[(N-methyl-N-phenylamino)methyl]pyrido[3,4-b]pyrazine-7-carbamate |
| ETHYL N-[2-AMINO-9-[(METHYL-PHENYL-AMINO)METHYL]-3,7,10-TRIAZABICYCLO[4.4.0]DECA-1,3,5,7,9-PENTAEN-4-YL]CARBAMATE |