ethyl (E)-3-[[2-amino-6-(ethoxycarbonylamino)pyridin-3-yl]amino]-3-phenyl-prop-2-enoate structure
|
Common Name | ethyl (E)-3-[[2-amino-6-(ethoxycarbonylamino)pyridin-3-yl]amino]-3-phenyl-prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 83269-29-8 | Molecular Weight | 370.40200 | |
| Density | 1.297g/cm3 | Boiling Point | 522.2ºC at 760 mmHg | |
| Molecular Formula | C19H22N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.6ºC | |
| Name | ethyl 3-[[2-amino-6-(ethoxycarbonylamino)pyridin-3-yl]amino]-3-phenylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.297g/cm3 |
|---|---|
| Boiling Point | 522.2ºC at 760 mmHg |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.40200 |
| Flash Point | 269.6ºC |
| Exact Mass | 370.16400 |
| PSA | 115.57000 |
| LogP | 3.97550 |
| Index of Refraction | 1.648 |
| InChIKey | JRWBQCBWQMVMAN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=C(Nc1ccc(NC(=O)OCC)nc1N)c1ccccc1 |
|
~%
ethyl (E)-3-[[2... CAS#:83269-29-8 |
| Literature: Temple Jr.; Wheeler; Elliott; Rose; Comber; Montgomery Journal of Medicinal Chemistry, 1983 , vol. 26, # 1 p. 91 - 95 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| ethyl 6-amino-5-<<1-(ethoxycarbonyl)-2-phenylethen-2-yl>amino>-2-pyridinecarbamate |
| ETHYL (E)-3-[[2-AMINO-6-(ETHOXYCARBONYLAMINO)(PYRIDIN-3-YL)]AMINO]-3-PHENYL-PROP-2-ENOATE |