1-(4-bromonaphthalen-1-yl)propan-2-one structure
|
Common Name | 1-(4-bromonaphthalen-1-yl)propan-2-one | ||
|---|---|---|---|---|
| CAS Number | 832716-20-8 | Molecular Weight | 263.13000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-bromonaphthalen-1-yl)propan-2-one |
|---|
| Molecular Formula | C13H11BrO |
|---|---|
| Molecular Weight | 263.13000 |
| Exact Mass | 261.99900 |
| PSA | 17.07000 |
| LogP | 3.73380 |
| InChIKey | AVIVYACXXAAEQD-UHFFFAOYSA-N |
| SMILES | CC(=O)Cc1ccc(Br)c2ccccc12 |
|
~%
1-(4-bromonapht... CAS#:832716-20-8 |
| Literature: Inui, Hiroshi; Murata, Shigeru Journal of the American Chemical Society, 2005 , vol. 127, # 8 p. 2628 - 2636 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |