1-(3,4-DIMETHYL-PHENYL)-4,4-DIFLUOROBUTANE-1,3-DIONE structure
|
Common Name | 1-(3,4-DIMETHYL-PHENYL)-4,4-DIFLUOROBUTANE-1,3-DIONE | ||
|---|---|---|---|---|
| CAS Number | 832740-29-1 | Molecular Weight | 226.21900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-Butanedione, 1-(3,4-dimethylphenyl)-4,4-difluoro |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12F2O2 |
|---|---|
| Molecular Weight | 226.21900 |
| Exact Mass | 226.08100 |
| PSA | 34.14000 |
| LogP | 2.71040 |
| InChIKey | IALCAMREMCZMLO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)CC(=O)C(F)F)cc1C |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(3,4-dimethylphenyl)-4,4-difluorobutane-1,3-dione |