Ethyl 5-Amino-1-(2,4-dichlorophenyl)-1H-pyrazole-4-carboxylate
Modify Date: 2025-09-25 17:05:02
Ethyl 5-Amino-1-(2,4-dichlorophenyl)-1H-pyrazole-4-carboxylate structure
|
Common Name | Ethyl 5-Amino-1-(2,4-dichlorophenyl)-1H-pyrazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 83279-66-7 | Molecular Weight | 300.14100 | |
| Density | 1.48g/cm3 | Boiling Point | 437.2ºC at 760 mmHg | |
| Molecular Formula | C12H11Cl2N3O2 | Melting Point | 175-178ºC | |
| MSDS | N/A | Flash Point | 218.2ºC | |
| Name | ethyl 5-amino-1-(2,4-dichlorophenyl)pyrazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 437.2ºC at 760 mmHg |
| Melting Point | 175-178ºC |
| Molecular Formula | C12H11Cl2N3O2 |
| Molecular Weight | 300.14100 |
| Flash Point | 218.2ºC |
| Exact Mass | 299.02300 |
| PSA | 70.14000 |
| LogP | 3.51920 |
| Index of Refraction | 1.639 |
| InChIKey | XOBRIYKLMQJCBQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnn(-c2ccc(Cl)cc2Cl)c1N |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 5-amino-1-(2,4-dichlorophenyl)-1H-pyrazole-4-carboxylate |
| 1H-Pyrazole-4-carboxylic acid,5-amino-1-(2,4-dichlorophenyl)-,ethyl ester |