5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide structure
|
Common Name | 5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 83296-77-9 | Molecular Weight | 230.22600 | |
| Density | 1.57g/cm3 | Boiling Point | 429ºC at 760 mmHg | |
| Molecular Formula | C10H10N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.2ºC | |
| Name | (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 429ºC at 760 mmHg |
| Molecular Formula | C10H10N6O |
| Molecular Weight | 230.22600 |
| Flash Point | 213.2ºC |
| Exact Mass | 230.09200 |
| PSA | 122.51000 |
| LogP | 2.78770 |
| Index of Refraction | 1.763 |
| InChIKey | REGGLIYWYURHMT-UHFFFAOYSA-N |
| SMILES | NC(=O)c1[nH]c(N=Nc2ccccc2)nc1N |
|
~95%
5-amino-2-(phen... CAS#:83296-77-9 |
| Literature: Baig, Ghouse Unissa; Stevens, Malcolm F. G.; Stone, Robert Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , # 8 p. 1811 - 1820 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-amino-2-phenylazoimidazole-4-carboxamide |