5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide
5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide structure
|
Common Name | 5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 83296-77-9 | Molecular Weight | 230.22600 | |
| Density | 1.57g/cm3 | Boiling Point | 429ºC at 760 mmHg | |
| Molecular Formula | C10H10N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.2ºC | |
Summary: (2E)-5-Amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide, Chinese name: 5-Amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide, CAS number: 83296-77-9, molecular formula: C10H10N6O, molecular weight: 230.22600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 429ºC at 760 mmHg |
| Molecular Formula | C10H10N6O |
| Molecular Weight | 230.22600 |
| Flash Point | 213.2ºC |
| Exact Mass | 230.09200 |
| PSA | 122.51000 |
| LogP | 2.78770 |
| Index of Refraction | 1.763 |
| InChIKey | REGGLIYWYURHMT-UHFFFAOYSA-N |
| SMILES | NC(=O)c1[nH]c(N=Nc2ccccc2)nc1N |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~95%
5-amino-2-(phen... CAS#:83296-77-9 |
| Literature: Baig, Ghouse Unissa; Stevens, Malcolm F. G.; Stone, Robert Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , # 8 p. 1811 - 1820 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-amino-2-phenylazoimidazole-4-carboxamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide? |
| A: LogP of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide is 2.78770. |
| Q: What is the boiling point of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide? |
| A: Boiling point of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide is 429ºC at 760 mmHg. |
| Q: What is the English name of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide? |
| A: The English name of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide is (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide. |
| Q: What is the molecular weight of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide? |
| A: Molecular weight of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide is 230.22600. |
| Q: What is the InChIKey of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide? |
| A: InChIKey of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide is REGGLIYWYURHMT-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 83296-77-9? |
| A: Chinese name of 83296-77-9 is 83296-77-9. |
| Q: What is the molecular formula of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide? |
| A: Molecular formula of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide is C10H10N6O. |
| Q: What is the CAS number of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide? |
| A: CAS number of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide is 83296-77-9. |
| Q: What is the polar surface area (PSA) of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide? |
| A: Polar surface area (PSA) of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide is 122.51000. |
| Q: What are the upstream materials of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide? |
| A: Related upstream materials(CAS) of (2E)-5-amino-2-(phenylhydrazinylidene)imidazole-4-carboxamide: 7008-85-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |