tert-butyl 4-methoxybenzoate structure
|
Common Name | tert-butyl 4-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 833-79-4 | Molecular Weight | 208.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16O3 |
|---|---|
| Molecular Weight | 208.25400 |
| Exact Mass | 208.11000 |
| PSA | 35.53000 |
| LogP | 2.65050 |
| InChIKey | VGNDQTDDMDZSAK-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)OC(C)(C)C)cc1 |
| HS Code | 2918990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,4-methoxy-,1,1-dimethylethyl ester |
| 4-methoxybenzoic acid t-butyl ester |
| 4-Methoxy-benzoesaeure-tert-butylester |
| 4-methoxy-benzoic acid tert-butyl ester |