Benzyl(4-(dimethylamino)phenyl)diphenylphosphonium iodide
Modify Date: 2025-09-10 00:34:43
Benzyl(4-(dimethylamino)phenyl)diphenylphosphonium iodide structure
|
Common Name | Benzyl(4-(dimethylamino)phenyl)diphenylphosphonium iodide | ||
|---|---|---|---|---|
| CAS Number | 83301-26-2 | Molecular Weight | 523.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H27INP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzyl(4-(dimethylamino)phenyl)diphenylphosphonium iodide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H27INP |
|---|---|
| Molecular Weight | 523.4 |
| InChIKey | IGTYTWMNYCDBHL-UHFFFAOYSA-M |
| SMILES | CN(C)c1ccc([P+](Cc2ccccc2)(c2ccccc2)c2ccccc2)cc1.[I-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 83301-26-2? |
| A: Chinese name of 83301-26-2 is 83301-26-2. |
| Q: What is the SMILES notation of Benzyl(4-(dimethylamino)phenyl)diphenylphosphonium iodide? |
| A: SMILES notation of Benzyl(4-(dimethylamino)phenyl)diphenylphosphonium iodide is CN(C)c1ccc([P+](Cc2ccccc2)(c2ccccc2)c2ccccc2)cc1.[I-]. |
| Q: What is the InChIKey of Benzyl(4-(dimethylamino)phenyl)diphenylphosphonium iodide? |
| A: InChIKey of Benzyl(4-(dimethylamino)phenyl)diphenylphosphonium iodide is IGTYTWMNYCDBHL-UHFFFAOYSA-M. |
| Q: What is the molecular weight of Benzyl(4-(dimethylamino)phenyl)diphenylphosphonium iodide? |
| A: Molecular weight of Benzyl(4-(dimethylamino)phenyl)diphenylphosphonium iodide is 523.4. |
| Q: What is the molecular formula of Benzyl(4-(dimethylamino)phenyl)diphenylphosphonium iodide? |
| A: Molecular formula of Benzyl(4-(dimethylamino)phenyl)diphenylphosphonium iodide is C27H27INP. |
| Q: What is the English name of Benzyl(4-(dimethylamino)phenyl)diphenylphosphonium iodide? |
| A: The English name of Benzyl(4-(dimethylamino)phenyl)diphenylphosphonium iodide is Benzyl(4-(dimethylamino)phenyl)diphenylphosphonium iodide. |
| Q: What is the CAS number of Benzyl(4-(dimethylamino)phenyl)diphenylphosphonium iodide? |
| A: CAS number of Benzyl(4-(dimethylamino)phenyl)diphenylphosphonium iodide is 83301-26-2. |