1,1-Ethanediamine,N,N'-bis(4-bromophenyl)-2,2,2-trichloro- structure
|
Common Name | 1,1-Ethanediamine,N,N'-bis(4-bromophenyl)-2,2,2-trichloro- | ||
|---|---|---|---|---|
| CAS Number | 83320-61-0 | Molecular Weight | 473.41800 | |
| Density | 1.847g/cm3 | Boiling Point | 556.2ºC at 760mmHg | |
| Molecular Formula | C14H11Br2Cl3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.2ºC | |
| Name | 1-N,1-N'-bis(4-bromophenyl)-2,2,2-trichloroethane-1,1-diamine |
|---|
| Density | 1.847g/cm3 |
|---|---|
| Boiling Point | 556.2ºC at 760mmHg |
| Molecular Formula | C14H11Br2Cl3N2 |
| Molecular Weight | 473.41800 |
| Flash Point | 290.2ºC |
| Exact Mass | 469.83500 |
| PSA | 24.06000 |
| LogP | 6.57790 |
| Index of Refraction | 1.704 |
| InChIKey | LPTYLIBUBROVDY-UHFFFAOYSA-N |
| SMILES | ClC(Cl)(Cl)C(Nc1ccc(Br)cc1)Nc1ccc(Br)cc1 |
|
~%
1,1-Ethanediami... CAS#:83320-61-0 |
| Literature: Wheeler Journal of the American Chemical Society, 1908 , vol. 30, p. 138 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |