4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine
4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine structure
|
Common Name | 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine | ||
|---|---|---|---|---|
| CAS Number | 833451-75-5 | Molecular Weight | 297.76100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12ClN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12ClN3O2S |
|---|---|
| Molecular Weight | 297.76100 |
| Exact Mass | 297.03400 |
| PSA | 95.56000 |
| LogP | 3.46180 |
| InChIKey | VGKJJGSUWHAVMN-UHFFFAOYSA-N |
| SMILES | COc1ccc(Sc2ncnc(Cl)c2N)cc1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~24%
4-chloro-6-(3,4... CAS#:833451-75-5 |
| Literature: Duncton, Matthew A. J.; Smith II, Leon M.; Burdzovic-Wizeman, Sabina; Burns, Aaron; Hu Liu, Yunyu Mao; Wong, Wai C.; Kiselyov, Alexander S. Journal of Organic Chemistry, 2005 , vol. 70, # 23 p. 9629 - 9631 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine? |
| A: The English name of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine is 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine. |
| Q: What is the molecular weight of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine? |
| A: Molecular weight of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine is 297.76100. |
| Q: What are the upstream materials of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine? |
| A: Related upstream materials(CAS) of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine: 5413-85-4;700-96-9. |
| Q: What is the molecular formula of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine? |
| A: Molecular formula of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine is C12H12ClN3O2S. |
| Q: What is the InChIKey of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine? |
| A: InChIKey of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine is VGKJJGSUWHAVMN-UHFFFAOYSA-N. |
| Q: What is the LogP of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine? |
| A: LogP of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine is 3.46180. |
| Q: What is the polar surface area (PSA) of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine? |
| A: Polar surface area (PSA) of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine is 95.56000. |
| Q: What is the CAS number of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine? |
| A: CAS number of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine is 833451-75-5. |
| Q: What is the Chinese name of 833451-75-5? |
| A: Chinese name of 833451-75-5 is 833451-75-5. |
| Q: What is the SMILES notation of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine? |
| A: SMILES notation of 4-chloro-6-(3,4-dimethoxyphenyl)sulfanylpyrimidin-5-amine is COc1ccc(Sc2ncnc(Cl)c2N)cc1OC. |