1-(4-bromophenyl)-3-(8-hydroxyquinolin-5-yl)prop-2-en-1-one structure
|
Common Name | 1-(4-bromophenyl)-3-(8-hydroxyquinolin-5-yl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 833488-09-8 | Molecular Weight | 354.19700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H12BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-bromophenyl)-3-(8-hydroxyquinolin-5-yl)prop-2-en-1-one |
|---|
| Molecular Formula | C18H12BrNO2 |
|---|---|
| Molecular Weight | 354.19700 |
| Exact Mass | 353.00500 |
| PSA | 50.19000 |
| LogP | 4.59900 |
| InChIKey | SXTMHXFBJSUWGV-UHFFFAOYSA-N |
| SMILES | O=C(C=Cc1ccc(O)c2ncccc12)c1ccc(Br)cc1 |
|
~69%
1-(4-bromopheny... CAS#:833488-09-8 |
| Literature: Marrugo-Gonzalez, Alonso J.; Orlov, Valerie D.; Fernandez-Maestre, Roberto Journal of the Chilean Chemical Society, 2012 , vol. 57, # 3 p. 1287 - 1291 |
|
~%
1-(4-bromopheny... CAS#:833488-09-8 |
| Literature: Marrugo-Gonzalez, Alonso J.; Orlov, Valerie D.; Fernandez-Maestre, Roberto Journal of the Chilean Chemical Society, 2012 , vol. 57, # 3 p. 1287 - 1291 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |