6-Carboxymethyl-6H-dibenzo(b,d)pyran structure
|
Common Name | 6-Carboxymethyl-6H-dibenzo(b,d)pyran | ||
|---|---|---|---|---|
| CAS Number | 83360-40-1 | Molecular Weight | 240.25400 | |
| Density | 1.269g/cm3 | Boiling Point | 474.3ºC at 760 mmHg | |
| Molecular Formula | C15H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.5ºC | |
| Name | 2-(6H-benzo[c]chromen-6-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.269g/cm3 |
|---|---|
| Boiling Point | 474.3ºC at 760 mmHg |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.25400 |
| Flash Point | 185.5ºC |
| Exact Mass | 240.07900 |
| PSA | 46.53000 |
| LogP | 3.26180 |
| Index of Refraction | 1.617 |
| InChIKey | RJFAXVGXCPTRGY-UHFFFAOYSA-N |
| SMILES | O=C(O)CC1Oc2ccccc2-c2ccccc21 |
| HS Code | 2916399090 |
|---|
|
~64%
6-Carboxymethyl... CAS#:83360-40-1 |
| Literature: Banzatti; Branzoli; Lovisolo; Melloni; Orsini; Salvadori Arzneimittel-Forschung/Drug Research, 1984 , vol. 34, # 8 p. 864 - 869 |
|
~%
6-Carboxymethyl... CAS#:83360-40-1 |
| Literature: Banzatti; Branzoli; Lovisolo; Melloni; Orsini; Salvadori Arzneimittel-Forschung/Drug Research, 1984 , vol. 34, # 8 p. 864 - 869 |
|
~%
6-Carboxymethyl... CAS#:83360-40-1 |
| Literature: Banzatti; Branzoli; Lovisolo; Melloni; Orsini; Salvadori Arzneimittel-Forschung/Drug Research, 1984 , vol. 34, # 8 p. 864 - 869 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 6-Carboxymethyl-6H-dibenzo(b,d)pyran |
| 6H,6-carboxymethyl-dibenzo[b,d]pyran |
| 6H-Dibenzo[b,d]pyran-6-aceticacid |