Bicyclo[4.1.0]heptane, 7,7-dichloro-1-methyl-4-(1-methylethenyl)- structure
|
Common Name | Bicyclo[4.1.0]heptane, 7,7-dichloro-1-methyl-4-(1-methylethenyl)- | ||
|---|---|---|---|---|
| CAS Number | 83387-33-1 | Molecular Weight | 219.15100 | |
| Density | 1.13g/cm3 | Boiling Point | 257.9ºC at 760mmHg | |
| Molecular Formula | C11H16Cl2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 94.1ºC | |
| Name | 7,7-dichloro-6-methyl-3-prop-1-en-2-ylbicyclo[4.1.0]heptane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 257.9ºC at 760mmHg |
| Molecular Formula | C11H16Cl2 |
| Molecular Weight | 219.15100 |
| Flash Point | 94.1ºC |
| Exact Mass | 218.06300 |
| LogP | 4.17260 |
| Index of Refraction | 1.513 |
| InChIKey | AXKHZXQWMPAXQC-UHFFFAOYSA-N |
| SMILES | C=C(C)C1CCC2(C)C(C1)C2(Cl)Cl |
|
~0%
Bicyclo[4.1.0]h... CAS#:83387-33-1 |
| Literature: Nomura, Eisaku; Taniguchi, Hisaji; Otsuji, Yoshio Bulletin of the Chemical Society of Japan, 1994 , vol. 67, # 3 p. 792 - 799 |
|
~%
Bicyclo[4.1.0]h... CAS#:83387-33-1 |
| Literature: Kimura,Y. et al. Chemistry Letters, 1977 , p. 951 - 954 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Bicyclo[4.1.0]heptane,7,7-dichloro-1-methyl-4-(1-methylethenyl) |
| 7,7-dichloro-1-methyl-4-(prop-1-en-2-yl)bicyclo[4.1.0]heptane |