N-(4-methoxyphenyl)-1,7-diazabicyclo[2.2.2]octane-7-carboxamide structure
|
Common Name | N-(4-methoxyphenyl)-1,7-diazabicyclo[2.2.2]octane-7-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 83407-81-2 | Molecular Weight | 261.32000 | |
| Density | 1.25g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-methoxyphenyl)-1,2-diazabicyclo[2.2.2]octane-2-carboxamide |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32000 |
| Exact Mass | 261.14800 |
| PSA | 44.81000 |
| LogP | 2.11850 |
| Index of Refraction | 1.618 |
| InChIKey | NENCIZMGBGGAAR-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)N2CC3CCN2CC3)cc1 |
|
~96%
N-(4-methoxyphe... CAS#:83407-81-2 |
| Literature: Kornet; Chu Journal of Heterocyclic Chemistry, 1982 , vol. 19, # 3 p. 697 - 698 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |