2-naphthalen-2-yloxy-5-nitropyridine structure
|
Common Name | 2-naphthalen-2-yloxy-5-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 83414-49-7 | Molecular Weight | 266.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-naphthalen-2-yloxy-5-nitropyridine |
|---|
| Molecular Formula | C15H10N2O3 |
|---|---|
| Molecular Weight | 266.25200 |
| Exact Mass | 266.06900 |
| PSA | 67.94000 |
| LogP | 4.45850 |
| InChIKey | PKKYICIDXVYJLE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc3ccccc3c2)nc1 |
|
~%
2-naphthalen-2-... CAS#:83414-49-7 |
| Literature: Friedman et al. Journal of the American Chemical Society, 1947 , vol. 69, p. 1204 |
|
~%
2-naphthalen-2-... CAS#:83414-49-7 |
| Literature: Kharaba, Mohamed A. H.; Nassar, Ahmad M. G.; Youssef, Abdel-Hamid A.; Faid-Allah, Hassan M. Polish Journal of Chemistry, 1991 , vol. 65, # 5-6 p. 1029 - 1034 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |