ICI 154,129 structure
|
Common Name | ICI 154,129 | ||
|---|---|---|---|---|
| CAS Number | 83420-94-4 | Molecular Weight | 638.82 | |
| Density | 1.189g/cm3 | Boiling Point | 929.4ºC at 760 mmHg | |
| Molecular Formula | C34H46N4O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 515.9ºC | |
Use of ICI 154,129ICI 154 129 is a delta-opioid receptor antagonist and can be used for seizure research. |
| Name | (2S)-2-[[(2S)-2-[2-[[2-[[(2S)-2-[bis(prop-2-enyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]ethylsulfanyl]-3-phenylpropanoyl]amino]-4-methylpentanoic acid |
|---|
| Description | ICI 154 129 is a delta-opioid receptor antagonist and can be used for seizure research. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 929.4ºC at 760 mmHg |
| Molecular Formula | C34H46N4O6S |
| Molecular Weight | 638.82 |
| Flash Point | 515.9ºC |
| Exact Mass | 638.31400 |
| PSA | 173.37000 |
| LogP | 4.34240 |
| Index of Refraction | 1.578 |
| InChIKey | CZRZYRKTYLLLRL-DTXPUJKBSA-N |
| SMILES | C=CCN(CC=C)C(Cc1ccc(O)cc1)C(=O)NCC(=O)NCCSC(Cc1ccccc1)C(=O)NC(CC(C)C)C(=O)O |