2-Methyl-6-hydroxyfluoran structure
|
Common Name | 2-Methyl-6-hydroxyfluoran | ||
|---|---|---|---|---|
| CAS Number | 83469-76-5 | Molecular Weight | 330.33300 | |
| Density | 1.45g/cm3 | Boiling Point | 561.9ºC at 760 mmHg | |
| Molecular Formula | C21H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.4ºC | |
| Name | 6'-hydroxy-2'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 561.9ºC at 760 mmHg |
| Molecular Formula | C21H14O4 |
| Molecular Weight | 330.33300 |
| Flash Point | 207.4ºC |
| Exact Mass | 330.08900 |
| PSA | 55.76000 |
| LogP | 4.26860 |
| Index of Refraction | 1.738 |
| InChIKey | ZRXDGIIVMARPCF-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)C1(OC(=O)c3ccccc31)c1ccc(O)cc1O2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6'-hydroxy-2'-methylfluoran |
| 6-Hydroxy-2-methylxanthen-9-spiro-1'-isobenzofuran-3'-one |
| 2-Methyl-6-hydroxyfluoran |