4-phenyl-4-pyridin-2-ylbutan-2-one
4-phenyl-4-pyridin-2-ylbutan-2-one structure
|
Common Name | 4-phenyl-4-pyridin-2-ylbutan-2-one | ||
|---|---|---|---|---|
| CAS Number | 83470-22-8 | Molecular Weight | 225.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-Phenyl-2-pyridin-2-ylbutan-2-one (CAS: 83470-22-8, molecular formula: C15H15NO, molecular weight: 225.29) For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-phenyl-4-pyridin-2-ylbutan-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H15NO |
|---|---|
| Molecular Weight | 225.28600 |
| Exact Mass | 225.11500 |
| PSA | 29.96000 |
| LogP | 3.19260 |
| InChIKey | NFOWVKNIOHUCBQ-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(c1ccccc1)c1ccccn1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~30%
4-phenyl-4-pyri... CAS#:83470-22-8 |
| Literature: Malmberg, Hans; Nilsson, Martin Journal of Organometallic Chemistry, 1983 , vol. 243, # 3 p. 241 - 244 |
|
~56%
4-phenyl-4-pyri... CAS#:83470-22-8 |
| Literature: Malmberg, Hans; Nilsson, Martin Journal of Organometallic Chemistry, 1983 , vol. 243, # 3 p. 241 - 244 |
|
~%
4-phenyl-4-pyri... CAS#:83470-22-8 |
| Literature: Murayama; Nakazawa Takamine Kenkyusho Nenpo, 1956 , vol. 8, p. 28,30 Chem.Abstr., 1958 , p. 378 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-phenyl-4-pyridin-2-ylbutan-2-one? |
| A: InChIKey of 4-phenyl-4-pyridin-2-ylbutan-2-one is NFOWVKNIOHUCBQ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-phenyl-4-pyridin-2-ylbutan-2-one? |
| A: Molecular formula of 4-phenyl-4-pyridin-2-ylbutan-2-one is C15H15NO. |
| Q: What is the polar surface area (PSA) of 4-phenyl-4-pyridin-2-ylbutan-2-one? |
| A: Polar surface area (PSA) of 4-phenyl-4-pyridin-2-ylbutan-2-one is 29.96000. |
| Q: What are the upstream materials of 4-phenyl-4-pyridin-2-ylbutan-2-one? |
| A: Related upstream materials(CAS) of 4-phenyl-4-pyridin-2-ylbutan-2-one: 85311-89-3;122-57-6;109-04-6;140-29-4. |
| Q: What is the English name of 4-phenyl-4-pyridin-2-ylbutan-2-one? |
| A: The English name of 4-phenyl-4-pyridin-2-ylbutan-2-one is 4-phenyl-4-pyridin-2-ylbutan-2-one. |
| Q: What is the Chinese name of 83470-22-8? |
| A: Chinese name of 83470-22-8 is 83470-22-8. |
| Q: What is the LogP of 4-phenyl-4-pyridin-2-ylbutan-2-one? |
| A: LogP of 4-phenyl-4-pyridin-2-ylbutan-2-one is 3.19260. |
| Q: What is the molecular weight of 4-phenyl-4-pyridin-2-ylbutan-2-one? |
| A: Molecular weight of 4-phenyl-4-pyridin-2-ylbutan-2-one is 225.28600. |
| Q: What is the SMILES notation of 4-phenyl-4-pyridin-2-ylbutan-2-one? |
| A: SMILES notation of 4-phenyl-4-pyridin-2-ylbutan-2-one is CC(=O)CC(c1ccccc1)c1ccccn1. |
| Q: What is the CAS number of 4-phenyl-4-pyridin-2-ylbutan-2-one? |
| A: CAS number of 4-phenyl-4-pyridin-2-ylbutan-2-one is 83470-22-8. |