2-amino-9-(2,4-dihydroxybutyl)-3H-purin-6-one structure
|
Common Name | 2-amino-9-(2,4-dihydroxybutyl)-3H-purin-6-one | ||
|---|---|---|---|---|
| CAS Number | 83470-65-9 | Molecular Weight | 239.23100 | |
| Density | 1.78g/cm3 | Boiling Point | 667.1ºC at 760 mmHg | |
| Molecular Formula | C9H13N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 357.3ºC | |
| Name | 2-amino-9-(2,4-dihydroxybutyl)-3H-purin-6-one |
|---|
| Density | 1.78g/cm3 |
|---|---|
| Boiling Point | 667.1ºC at 760 mmHg |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.23100 |
| Flash Point | 357.3ºC |
| Exact Mass | 239.10200 |
| PSA | 131.04000 |
| Index of Refraction | 1.784 |
| InChIKey | BOVGCIHOTQTZKJ-UHFFFAOYSA-N |
| SMILES | Nc1nc2c(ncn2CC(O)CCO)c(=O)[nH]1 |
|
~80%
2-amino-9-(2,4-... CAS#:83470-65-9 |
| Literature: Martin; Smee; Verheyden Journal of Organic Chemistry, 1985 , vol. 50, # 6 p. 755 - 759 |
|
~%
2-amino-9-(2,4-... CAS#:83470-65-9 |
| Literature: Martin; Smee; Verheyden Journal of Organic Chemistry, 1985 , vol. 50, # 6 p. 755 - 759 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |