1-methyl-3-phenyl-1-(1-pyridin-2-ylethylamino)thiourea structure
|
Common Name | 1-methyl-3-phenyl-1-(1-pyridin-2-ylethylamino)thiourea | ||
|---|---|---|---|---|
| CAS Number | 83476-91-9 | Molecular Weight | 286.39500 | |
| Density | 1.223g/cm3 | Boiling Point | 408ºC at 760 mmHg | |
| Molecular Formula | C15H18N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.6ºC | |
| Name | 1-methyl-3-phenyl-1-(1-pyridin-2-ylethylamino)thiourea |
|---|
| Density | 1.223g/cm3 |
|---|---|
| Boiling Point | 408ºC at 760 mmHg |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.39500 |
| Flash Point | 200.6ºC |
| Exact Mass | 286.12500 |
| PSA | 72.28000 |
| LogP | 3.43990 |
| Index of Refraction | 1.664 |
| InChIKey | MTPUVIBRQBWLCK-UHFFFAOYSA-N |
| SMILES | CC(NN(C)C(=S)Nc1ccccc1)c1ccccn1 |
|
~41%
1-methyl-3-phen... CAS#:83476-91-9 |
| Literature: Klayman; Scovill; Bartosevich; Bruce Journal of Medicinal Chemistry, 1983 , vol. 26, # 1 p. 35 - 39 |
|
~%
1-methyl-3-phen... CAS#:83476-91-9 |
| Literature: Klayman; Scovill; Bartosevich; Bruce Journal of Medicinal Chemistry, 1983 , vol. 26, # 1 p. 35 - 39 |
|
~%
1-methyl-3-phen... CAS#:83476-91-9 |
| Literature: Klayman; Scovill; Bartosevich; Bruce Journal of Medicinal Chemistry, 1983 , vol. 26, # 1 p. 35 - 39 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |