4-(4-FLUOROPHENYL)-2(3H)-THIAZOLONE structure
|
Common Name | 4-(4-FLUOROPHENYL)-2(3H)-THIAZOLONE | ||
|---|---|---|---|---|
| CAS Number | 834885-06-2 | Molecular Weight | 195.21300 | |
| Density | 1.393g/cm3 | Boiling Point | 379.9ºC at 760 mmHg | |
| Molecular Formula | C9H6FNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.6ºC | |
| Name | 4-(4-fluorophenyl)-3H-1,3-thiazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.393g/cm3 |
|---|---|
| Boiling Point | 379.9ºC at 760 mmHg |
| Molecular Formula | C9H6FNOS |
| Molecular Weight | 195.21300 |
| Flash Point | 183.6ºC |
| Exact Mass | 195.01500 |
| PSA | 61.36000 |
| LogP | 2.65480 |
| Index of Refraction | 1.619 |
| InChIKey | VDFFNDUNESKYCU-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(-c2ccc(F)cc2)cs1 |
| HS Code | 2934100090 |
|---|
|
~%
4-(4-FLUOROPHEN... CAS#:834885-06-2 |
| Literature: sanofi-aventis Patent: EP1939181 A1, 2008 ; Location in patent: Page/Page column 50 ; EP 1939181 A1 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-(4-Fluorophenyl)thiazol-2-ol |
| 4-(4-fluorophenyl)-2,3-dihydro-1,3-thiazol-2-one |