2,2,5,8-tetramethyl-7-oxido-4H-[1,3]dioxino[4,5-c]pyridin-7-ium structure
|
Common Name | 2,2,5,8-tetramethyl-7-oxido-4H-[1,3]dioxino[4,5-c]pyridin-7-ium | ||
|---|---|---|---|---|
| CAS Number | 83492-45-9 | Molecular Weight | 209.24200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,5,8-tetramethyl-7-oxido-4H-[1,3]dioxino[4,5-c]pyridin-7-ium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H15NO3 |
|---|---|
| Molecular Weight | 209.24200 |
| Exact Mass | 209.10500 |
| PSA | 43.92000 |
| LogP | 2.37700 |
| InChIKey | LYFNCOUITUJCLL-UHFFFAOYSA-N |
| SMILES | Cc1c[n+]([O-])c(C)c2c1COC(C)(C)O2 |
|
~89%
2,2,5,8-tetrame... CAS#:83492-45-9 |
| Literature: Iwata, Masaaki; Kuzuhara, Hiroyoshi Bulletin of the Chemical Society of Japan, 1982 , vol. 55, # 7 p. 2153 - 2157 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5'-deoxy-3,4'-O-isopropylidenepyridoxine 1-oxide |