2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenyl-ethanol structure
|
Common Name | 2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenyl-ethanol | ||
|---|---|---|---|---|
| CAS Number | 83502-00-5 | Molecular Weight | 316.26900 | |
| Density | 1.44g/cm3 | Boiling Point | 501.7ºC at 760 mmHg | |
| Molecular Formula | C14H12N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.2ºC | |
| Name | 2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenylethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 501.7ºC at 760 mmHg |
| Molecular Formula | C14H12N4O5 |
| Molecular Weight | 316.26900 |
| Flash Point | 257.2ºC |
| Exact Mass | 316.08100 |
| PSA | 136.26000 |
| LogP | 3.43090 |
| Index of Refraction | 1.656 |
| InChIKey | HBCZLTVHJHKEPN-DTQAZKPQSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=C(CO)c2ccccc2)c([N+](=O)[O-])c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Benzoylcarbinol-2.4-dinitro-phenylhydrazon |
| 2-hydroxy-1-nitroheptane |
| 1-nitro-2-heptanol |
| 1-nitro-heptan-2-ol |
| 1-nitromethyl-1-hexanol |