3-phenyl-2-phenylimino-1,3-thiazolidin-5-one structure
|
Common Name | 3-phenyl-2-phenylimino-1,3-thiazolidin-5-one | ||
|---|---|---|---|---|
| CAS Number | 83507-17-9 | Molecular Weight | 268.33400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-phenyl-2-phenylimino-1,3-thiazolidin-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H12N2OS |
|---|---|
| Molecular Weight | 268.33400 |
| Exact Mass | 268.06700 |
| PSA | 57.97000 |
| LogP | 3.51910 |
| InChIKey | RQUGDSHNOZHGDZ-UHFFFAOYSA-N |
| SMILES | O=C1CN(c2ccccc2)C(=Nc2ccccc2)S1 |
|
~81%
3-phenyl-2-phen... CAS#:83507-17-9 |
| Literature: Metwally; Keshk; Fekry; Etman Phosphorus, Sulfur and Silicon and the Related Elements, 2004 , vol. 179, # 10 p. 2067 - 2079 |
|
~52%
3-phenyl-2-phen... CAS#:83507-17-9 |
| Literature: Okawara, Tadashi; Nakayama, Kentaro; Furukawa, Mitsuru Heterocycles, 1982 , vol. 19, # 9 p. 1571 - 1574 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-phenyl-2-phenyliminothiazolidin-5-one |
| HMS1680B02 |