methyl 2-(1-hydroxy-3-methyl-4-oxo-naphthalen-1-yl)acetate structure
|
Common Name | methyl 2-(1-hydroxy-3-methyl-4-oxo-naphthalen-1-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 83553-01-9 | Molecular Weight | 246.25900 | |
| Density | 1.249g/cm3 | Boiling Point | 410ºC at 760 mmHg | |
| Molecular Formula | C14H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.7ºC | |
| Name | methyl 2-(1-hydroxy-3-methyl-4-oxonaphthalen-1-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 410ºC at 760 mmHg |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.25900 |
| Flash Point | 155.7ºC |
| Exact Mass | 246.08900 |
| PSA | 63.60000 |
| LogP | 1.57990 |
| Index of Refraction | 1.57 |
| InChIKey | MLWIYELTJOHTPR-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1(O)C=C(C)C(=O)c2ccccc21 |
|
~63%
methyl 2-(1-hyd... CAS#:83553-01-9 |
| Literature: Araki, Shuki; Katsumura, Nobuhito; Kawasaki, Ken-ichi; Butsugan, Yasuo Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1991 , # 3 p. 499 - 500 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| methyl (1,4-dihydro-1-hydroxy-3-methyl-4-oxo-1-naphthalene)acetate |