(3-azido-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-phenylmethanone structure
|
Common Name | (3-azido-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 835626-21-6 | Molecular Weight | 308.35800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-azido-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-phenylmethanone |
|---|
| Molecular Formula | C16H12N4OS |
|---|---|
| Molecular Weight | 308.35800 |
| Exact Mass | 308.07300 |
| PSA | 107.95000 |
| LogP | 4.53866 |
| InChIKey | GKIJLRGLRIKKEB-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2c(N=[N+]=[N-])c(C(=O)c3ccccc3)sc2n1 |
|
~76%
(3-azido-4,6-di... CAS#:835626-21-6 |
| Literature: Vasilin; Kaigorodova; Firgang; Krapivin Chemistry of Heterocyclic Compounds, 2004 , vol. 40, # 3 p. 377 - 386 |
|
~%
(3-azido-4,6-di... CAS#:835626-21-6 |
| Literature: Vasilin; Kaigorodova; Firgang; Krapivin Chemistry of Heterocyclic Compounds, 2004 , vol. 40, # 3 p. 377 - 386 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |