2H-Indazole-4,7-dione,3-butyl-5-(phenylamino)- structure
|
Common Name | 2H-Indazole-4,7-dione,3-butyl-5-(phenylamino)- | ||
|---|---|---|---|---|
| CAS Number | 83578-17-0 | Molecular Weight | 295.33600 | |
| Density | 1.325g/cm3 | Boiling Point | 546.8ºC at 760mmHg | |
| Molecular Formula | C17H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.5ºC | |
| Name | 5-anilino-3-butyl-2H-indazole-4,7-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.325g/cm3 |
|---|---|
| Boiling Point | 546.8ºC at 760mmHg |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.33600 |
| Flash Point | 284.5ºC |
| Exact Mass | 295.13200 |
| PSA | 74.85000 |
| LogP | 3.20030 |
| Index of Refraction | 1.672 |
| InChIKey | WQVILOGVGRBUPL-UHFFFAOYSA-N |
| SMILES | CCCCc1[nH]nc2c1C(=O)C(Nc1ccccc1)=CC2=O |
|
~68%
2H-Indazole-4,7... CAS#:83578-17-0 |
| Literature: Singh; Khanna; Anand Indian Journal of Chemistry - Section B Organic Chemistry Including Medicinal Chemistry, 1989 , vol. 28, # 6 p. 490 - 493 |
|
~%
2H-Indazole-4,7... CAS#:83578-17-0 |
| Literature: Singh; Khanna; Anand Indian Journal of Chemistry - Section B Organic Chemistry Including Medicinal Chemistry, 1989 , vol. 28, # 6 p. 490 - 493 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2H-5-anilino-3-butyl-4,7-indazoloquinone |