1,8-diamino-2,4,5,7-tetrachloroanthraquinone
Modify Date: 2025-10-10 19:42:31
1,8-diamino-2,4,5,7-tetrachloroanthraquinone structure
|
Common Name | 1,8-diamino-2,4,5,7-tetrachloroanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 83578-92-1 | Molecular Weight | 376.02200 | |
| Density | 1.778g/cm3 | Boiling Point | 648.2ºC at 760 mmHg | |
| Molecular Formula | C14H6Cl4N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 345.8ºC | |
| Name | 1,8-diamino-2,4,5,7-tetrachloroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.778g/cm3 |
|---|---|
| Boiling Point | 648.2ºC at 760 mmHg |
| Molecular Formula | C14H6Cl4N2O2 |
| Molecular Weight | 376.02200 |
| Flash Point | 345.8ºC |
| Exact Mass | 373.91800 |
| PSA | 86.18000 |
| LogP | 5.40240 |
| Index of Refraction | 1.756 |
| InChIKey | ADWASFABXNYXBP-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cc(Cl)c2c1C(=O)c1c(N)c(Cl)cc(Cl)c1C2=O |
| HS Code | 2922399090 |
|---|
|
~%
1,8-diamino-2,4... CAS#:83578-92-1 |
| Literature: Bad. Anilin- u. Sodaf. Patent: DE158951 ; |
|
~%
1,8-diamino-2,4... CAS#:83578-92-1 |
| Literature: Bad. Anilin- u. Sodaf. Patent: DE158951 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1,8-Diamino-2,4,5,7-tetrachlor-anthrachinon |
| 1,8-Diamino-2,4,5,7-tetrachloroanthraquinone |
| EINECS 280-497-0 |