Azirino[2,3:3,4]pyrrolo[1,2-a]indole-4,7-dione, 8-[[(aminocarbonyl)oxy]methyl]-6-[[2-(ethylthio)ethyl]amino]-1,1a, 2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-, [1aR-(1a.alpha.,8.beta., 8a.alpha.,8b.alpha structure
|
Common Name | Azirino[2,3:3,4]pyrrolo[1,2-a]indole-4,7-dione, 8-[[(aminocarbonyl)oxy]methyl]-6-[[2-(ethylthio)ethyl]amino]-1,1a, 2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-, [1aR-(1a.alpha.,8.beta., 8a.alpha.,8b.alpha | ||
|---|---|---|---|---|
| CAS Number | 83586-83-8 | Molecular Weight | 422.49900 | |
| Density | 1.42g/cm3 | Boiling Point | 650.4ºC at 760 mmHg | |
| Molecular Formula | C19H26N4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 347.1ºC | |
| Name | nsc339668 |
|---|
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 650.4ºC at 760 mmHg |
| Molecular Formula | C19H26N4O5S |
| Molecular Weight | 422.49900 |
| Flash Point | 347.1ºC |
| Exact Mass | 422.16200 |
| PSA | 158.20000 |
| LogP | 1.09070 |
| Index of Refraction | 1.645 |
| InChIKey | MMZJUSFHXRFABU-WPTVWNQNSA-N |
| SMILES | CCSCCNC1=C(C)C(=O)C2=C(C1=O)C(COC(N)=O)C1(OC)C3NC3CN21 |
|
~75%
Azirino[2,3:3,4... CAS#:83586-83-8 |
| Literature: Iyengar; Sami; Remers; Bradner; Schurig Journal of Medicinal Chemistry, 1983 , vol. 26, # 1 p. 16 - 20 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |