Azirino[2',3':3,4]pyrrolo[1,2-a]indole-4,7-dione,8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-6-[[2-(1-pyrrolidinyl)ethyl]amino]-,[1aS-(1aa,8b,8aa,8ba)]- (9CI) structure
|
Common Name | Azirino[2',3':3,4]pyrrolo[1,2-a]indole-4,7-dione,8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-6-[[2-(1-pyrrolidinyl)ethyl]amino]-,[1aS-(1aa,8b,8aa,8ba)]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 83586-87-2 | Molecular Weight | 431.48500 | |
| Density | 1.42g/cm3 | Boiling Point | 657.3ºC at 760 mmHg | |
| Molecular Formula | C21H29N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 351.4ºC | |
| Name | nsc336239 |
|---|
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 657.3ºC at 760 mmHg |
| Molecular Formula | C21H29N5O5 |
| Molecular Weight | 431.48500 |
| Flash Point | 351.4ºC |
| Exact Mass | 431.21700 |
| PSA | 136.14000 |
| LogP | 0.37130 |
| Index of Refraction | 1.651 |
| InChIKey | OHFVQOCCASKYQK-PGDDNOQISA-N |
| SMILES | COC12C(COC(N)=O)C3=C(C(=O)C(C)=C(NCCN4CCCC4)C3=O)N1CC1NC12 |
|
~61%
Azirino[2',3':3... CAS#:83586-87-2 |
| Literature: Iyengar; Sami; Remers; Bradner; Schurig Journal of Medicinal Chemistry, 1983 , vol. 26, # 1 p. 16 - 20 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |