L-Cystine, N,N-bis[(4-aminophenyl)sulfonyl]- structure
|
Common Name | L-Cystine, N,N-bis[(4-aminophenyl)sulfonyl]- | ||
|---|---|---|---|---|
| CAS Number | 83626-72-6 | Molecular Weight | 550.64900 | |
| Density | 1.619g/cm3 | Boiling Point | 864.6ºC at 760 mmHg | |
| Molecular Formula | C18H22N4O8S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 476.7ºC | |
| Name | 1,2-bis-sulfanilylamino-ethane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.619g/cm3 |
|---|---|
| Boiling Point | 864.6ºC at 760 mmHg |
| Molecular Formula | C18H22N4O8S4 |
| Molecular Weight | 550.64900 |
| Flash Point | 476.7ºC |
| Exact Mass | 550.03200 |
| PSA | 286.34000 |
| LogP | 4.50140 |
| Index of Refraction | 1.695 |
| InChIKey | FIPMCOYOJDSDBZ-HOTGVXAUSA-N |
| SMILES | Nc1ccc(S(=O)(=O)NC(CSSCC(NS(=O)(=O)c2ccc(N)cc2)C(=O)O)C(=O)O)cc1 |
|
~%
L-Cystine, N,N-... CAS#:83626-72-6 |
| Literature: Irreverre; Sullivan Journal of the American Chemical Society, 1942 , vol. 64, p. 1488 |
|
~%
L-Cystine, N,N-... CAS#:83626-72-6 |
| Literature: Irreverre; Sullivan Journal of the American Chemical Society, 1942 , vol. 64, p. 1488 |
|
~%
L-Cystine, N,N-... CAS#:83626-72-6 |
| Literature: Irreverre; Sullivan Journal of the American Chemical Society, 1942 , vol. 64, p. 1488 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Alflow AD 61B |
| N,N'-p-phenylene-bis-stearamide |
| N.N'-Distearoyl-p-phenylendiamin |
| N,N'-1,4-Phenylenebisoctadecanamide |
| N,N'-p-Phenylen-bis-stearamid |
| Stearamide,N,N'-p-phenylenebis |
| N.N'-Disulfanilyl-aethylendiamin |
| N.N'-Disulfanilyl-L-cystin |
| N.N'-disulfanilyl-L-cystine |
| N.N'-Distearyl-p-phenylendiamin |
| p-Phenylenebisstearamide |
| Octadecanamide,N,N'-1,4-phenylenebis |
| 1,2-Bis-sulfanilylamino-aethan |