1-(4-chlorophenoxy)-4-methylsulfonylbenzene structure
|
Common Name | 1-(4-chlorophenoxy)-4-methylsulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 83642-21-1 | Molecular Weight | 282.74300 | |
| Density | 1.322g/cm3 | Boiling Point | 433.9ºC at 760 mmHg | |
| Molecular Formula | C13H11ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.2ºC | |
| Name | 1-(4-chlorophenoxy)-4-methylsulfonylbenzene |
|---|
| Density | 1.322g/cm3 |
|---|---|
| Boiling Point | 433.9ºC at 760 mmHg |
| Molecular Formula | C13H11ClO3S |
| Molecular Weight | 282.74300 |
| Flash Point | 216.2ºC |
| Exact Mass | 282.01200 |
| PSA | 51.75000 |
| LogP | 4.61660 |
| Index of Refraction | 1.583 |
| InChIKey | VVLHURRVXVQCTO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc(Cl)cc2)cc1 |
|
~%
1-(4-chlorophen... CAS#:83642-21-1 |
| Literature: The Dow Chemical Company Patent: US4349568 A1, 1982 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |