[4-(4-methylsulfonylphenoxy)phenyl]-phenylmethanone structure
|
Common Name | [4-(4-methylsulfonylphenoxy)phenyl]-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 83642-23-3 | Molecular Weight | 352.40400 | |
| Density | 1.258g/cm3 | Boiling Point | 541.6ºC at 760 mmHg | |
| Molecular Formula | C20H16O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.3ºC | |
| Name | [4-(4-methylsulfonylphenoxy)phenyl]-phenylmethanone |
|---|
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 541.6ºC at 760 mmHg |
| Molecular Formula | C20H16O4S |
| Molecular Weight | 352.40400 |
| Flash Point | 281.3ºC |
| Exact Mass | 352.07700 |
| PSA | 68.82000 |
| LogP | 5.19420 |
| Index of Refraction | 1.602 |
| InChIKey | IVGZMLRAOPYXIF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc(C(=O)c3ccccc3)cc2)cc1 |
|
~%
[4-(4-methylsul... CAS#:83642-23-3 |
| Literature: The Dow Chemical Company Patent: US4349568 A1, 1982 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |