1-methoxy-4-(4-methylsulfonylphenoxy)benzene structure
|
Common Name | 1-methoxy-4-(4-methylsulfonylphenoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 83642-37-9 | Molecular Weight | 278.32400 | |
| Density | 1.232g/cm3 | Boiling Point | 442.1ºC at 760 mmHg | |
| Molecular Formula | C14H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.2ºC | |
| Name | 1-methoxy-4-(4-methylsulfonylphenoxy)benzene |
|---|
| Density | 1.232g/cm3 |
|---|---|
| Boiling Point | 442.1ºC at 760 mmHg |
| Molecular Formula | C14H14O4S |
| Molecular Weight | 278.32400 |
| Flash Point | 221.2ºC |
| Exact Mass | 278.06100 |
| PSA | 60.98000 |
| LogP | 3.97180 |
| Index of Refraction | 1.559 |
| InChIKey | ZXJPTGLBIYKSDJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(Oc2ccc(S(C)(=O)=O)cc2)cc1 |
|
~%
1-methoxy-4-(4-... CAS#:83642-37-9 |
| Literature: The Dow Chemical Company Patent: US4349568 A1, 1982 ; |
|
~%
1-methoxy-4-(4-... CAS#:83642-37-9 |
| Literature: Chen, Zheng; Wu, Yiran; Liu, Ying; Yang, Suijia; Chen, Yunjie; Lai, Luhua Journal of Medicinal Chemistry, 2011 , vol. 54, # 10 p. 3650 - 3660 |