(R)-AMPA structure
|
Common Name | (R)-AMPA | ||
|---|---|---|---|---|
| CAS Number | 83654-13-1 | Molecular Weight | 186.165 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (R)-AMPA(R)-AMPA is an inactive isomer of (RS)-AMPA (MedKoo Cat# 573831). |
| Name | (2R)-2-amino-3-(5-methyl-3-oxo-1,2-oxazol-4-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C7H10N2O4 |
| Molecular Weight | 186.165 |
| Exact Mass | 186.064056 |
| PSA | 109.58000 |
| LogP | 0.40 |
| Index of Refraction | 1.542 |
| InChIKey | UUDAMDVQRQNNHZ-RXMQYKEDSA-N |
| SMILES | Cc1o[nH]c(=O)c1CC(N)C(=O)O |
| WGK Germany | 3 |
|---|---|
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(5-Methyl-3-oxo-2,3-dihydro-1,2-oxazol-4-yl)-D-alanine |
| (-)-Ampa |
| UNII-F45TJ02EL1 |
| Tocris-0253 |
| D-AMPA |
| (R)-AMPA |
| Ampa,D |
| 4-Isoxazolepropanoic acid, α-amino-2,3-dihydro-5-methyl-3-oxo-, (αR)- |