RH 237 structure
|
Common Name | RH 237 | ||
|---|---|---|---|---|
| CAS Number | 83668-91-1 | Molecular Weight | 497.71200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H41N2O3S+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RH 237RH 237 is a voltage-sensitive fluorescent dye. RH 237 can be used for imaging neuron cells[1]. |
| Name | Neurodye RH-237, pure |
|---|---|
| Synonym | More Synonyms |
| Description | RH 237 is a voltage-sensitive fluorescent dye. RH 237 can be used for imaging neuron cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C29H41N2O3S+ |
|---|---|
| Molecular Weight | 497.71200 |
| Exact Mass | 497.28400 |
| PSA | 69.87000 |
| LogP | 7.41230 |
| InChIKey | VJFBYTPFDXZYDN-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)c1ccc(C=CC=CC=Cc2cc[n+](CCCCS(=O)(=O)[O-])cc2)cc1 |
| MFCD01635333 |