methyl 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-hydroxybutanoate structure
|
Common Name | methyl 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-hydroxybutanoate | ||
|---|---|---|---|---|
| CAS Number | 83677-20-7 | Molecular Weight | 334.45000 | |
| Density | 1.07g/cm3 | Boiling Point | 453.1ºC at 760 mmHg | |
| Molecular Formula | C20H30O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.5ºC | |
| Name | methyl 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-hydroxybutanoate |
|---|
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 453.1ºC at 760 mmHg |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.45000 |
| Flash Point | 150.5ºC |
| Exact Mass | 334.21400 |
| PSA | 66.76000 |
| LogP | 3.92600 |
| Index of Refraction | 1.538 |
| InChIKey | JEYSKSLKODWJJR-GXDHUFHOSA-N |
| SMILES | COC(=O)C(=Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)CCO |
|
~%
methyl 2-[(3,5-... CAS#:83677-20-7 |
| Literature: Katsumi; Kondo; Fuse; Yamashita; Hidaka; Hosoe; Takeo; Watanabe Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 4 p. 1619 - 1627 |
|
~%
methyl 2-[(3,5-... CAS#:83677-20-7 |
| Literature: Katsumi; Kondo; Fuse; Yamashita; Hidaka; Hosoe; Takeo; Watanabe Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 4 p. 1619 - 1627 |
|
~%
methyl 2-[(3,5-... CAS#:83677-20-7 |
| Literature: Katsumi; Kondo; Fuse; Yamashita; Hidaka; Hosoe; Takeo; Watanabe Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 4 p. 1619 - 1627 |