alpha-(3,5-di-tert-Butyl-4-hydroxybenzylidene)gamma-butyrolactone
Modify Date: 2025-09-22 17:42:36
alpha-(3,5-di-tert-Butyl-4-hydroxybenzylidene)gamma-butyrolactone structure
|
Common Name | alpha-(3,5-di-tert-Butyl-4-hydroxybenzylidene)gamma-butyrolactone | ||
|---|---|---|---|---|
| CAS Number | 83677-24-1 | Molecular Weight | 302.40800 | |
| Density | 1.096g/cm3 | Boiling Point | 429.1ºC at 760 mmHg | |
| Molecular Formula | C19H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.4ºC | |
| Name | (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]oxolan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.096g/cm3 |
|---|---|
| Boiling Point | 429.1ºC at 760 mmHg |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.40800 |
| Flash Point | 170.4ºC |
| Exact Mass | 302.18800 |
| PSA | 46.53000 |
| LogP | 4.31750 |
| Index of Refraction | 1.562 |
| InChIKey | DFPYHQJPGCODSB-LCYFTJDESA-N |
| SMILES | CC(C)(C)c1cc(C=C2CCOC2=O)cc(C(C)(C)C)c1O |
| HS Code | 2932209090 |
|---|
|
~80%
alpha-(3,5-di-t... CAS#:83677-24-1 |
| Literature: Katsumi; Kondo; Yamashita; Hidaka; Hosoe; Watanabe Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 1 p. 121 - 129 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| kme 4 |