Nitro-glu-P-1 structure
|
Common Name | Nitro-glu-P-1 | ||
|---|---|---|---|---|
| CAS Number | 83692-82-4 | Molecular Weight | 228.20700 | |
| Density | 1.53g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H8N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Nitro-glu-P-1 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Molecular Formula | C11H8N4O2 |
| Molecular Weight | 228.20700 |
| Exact Mass | 228.06500 |
| PSA | 76.01000 |
| LogP | 2.62230 |
| Index of Refraction | 1.757 |
| InChIKey | MKGAVJXZBKHNNJ-UHFFFAOYSA-N |
| SMILES | Cc1cccn2c1nc1ccc([N+](=O)[O-])nc12 |
| HS Code | 2933990090 |
|---|
|
~71%
Nitro-glu-P-1 CAS#:83692-82-4 |
| Literature: Hashimoto, Yuichi; Shudo, Koichi; Okamoto, Toshihiko Journal of the American Chemical Society, 1982 , vol. 104, # 26 p. 7636 - 7640 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-nitro-6-methyldipyridi<1,2-a:3',2'-d>imidazole |